C7H6ClF9O — CID 163434337
3-chloro-1,1,1-trifluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-methylpropane (PubChem CID 163434337) has the molecular formula C7H6ClF9O and a molecular weight of 312.56 g/mol. Its IUPAC name is 3-chloro-1,1,1-trifluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-methylpropane.
| Compound Name | 3-chloro-1,1,1-trifluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-methylpropane |
|---|---|
| PubChem CID | 163434337 |
| Molecular Formula | C7H6ClF9O |
| Molecular Weight | 312.56 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 3-chloro-1,1,1-trifluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-methylpropane |
| SMILES | CC(CCl)(OC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6ClF9O/c1-4(2-8,7(15,16)17)18-3(5(9,10)11)6(12,13)14/h3H,2H2,1H3 |
| InChIKey | ATDQUULSKQNINL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|