C9H2F18O — CID 88558617
1,1,1,2,3,4,5,5,5-nonafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-(trifluoromethyl)pentane (PubChem CID 88558617) has the molecular formula C9H2F18O and a molecular weight of 468.08 g/mol. Its IUPAC name is 1,1,1,2,3,4,5,5,5-nonafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-(trifluoromethyl)pentane.
| Compound Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-(trifluoromethyl)pentane |
|---|---|
| PubChem CID | 88558617 |
| Molecular Formula | C9H2F18O |
| Molecular Weight | 468.08 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | 1,1,1,2,3,4,5,5,5-nonafluoro-2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-4-(trifluoromethyl)pentane |
| SMILES | FC(C(F)(OC(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H2F18O/c10-1(3(11,7(19,20)21)8(22,23)24)4(12,9(25,26)27)28-2(5(13,14)15)6(16,17)18/h1-2H |
| InChIKey | MIIFKNJRQYUCNG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.08 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |