C9H3BF18O3 — CID 53443426
tris(1,1,1,2,3,3-hexafluoropropan-2-yl) borate (PubChem CID 53443426) has the molecular formula C9H3BF18O3 and a molecular weight of 511.90 g/mol. Its IUPAC name is tris(1,1,1,2,3,3-hexafluoropropan-2-yl) borate.
| Compound Name | tris(1,1,1,2,3,3-hexafluoropropan-2-yl) borate |
|---|---|
| PubChem CID | 53443426 |
| Molecular Formula | C9H3BF18O3 |
| Molecular Weight | 511.90 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | tris(1,1,1,2,3,3-hexafluoropropan-2-yl) borate |
| SMILES | FC(F)C(F)(OB(OC(F)(C(F)F)C(F)(F)F)OC(F)(C(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H3BF18O3/c11-1(12)4(17,7(20,21)22)29-10(30-5(18,2(13)14)8(23,24)25)31-6(19,3(15)16)9(26,27)28/h1-3H |
| InChIKey | WWRGHOUGSXNSIQ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.90 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|