C7H6F12O2Si — CID 173028343
bis(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-methylsilane (PubChem CID 173028343) has the molecular formula C7H6F12O2Si and a molecular weight of 378.19 g/mol. Its IUPAC name is bis(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-methylsilane.
| Compound Name | bis(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-methylsilane |
|---|---|
| PubChem CID | 173028343 |
| Molecular Formula | C7H6F12O2Si |
| Molecular Weight | 378.19 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | bis(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-methylsilane |
| SMILES | C[SiH](OC(F)(C(F)F)C(F)(F)F)OC(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F12O2Si/c1-22(20-4(12,2(8)9)6(14,15)16)21-5(13,3(10)11)7(17,18)19/h2-3,22H,1H3 |
| InChIKey | SCZLZRAXJBKEPO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.19 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|