C13H26F5NOSi — CID 152743593
3-dimethylsilyloxy-1,1,1,2,2-pentafluoro-N,N,4,4,5-pentamethylhexan-3-amine (PubChem CID 152743593) has the molecular formula C13H26F5NOSi and a molecular weight of 335.43 g/mol. Its IUPAC name is 3-dimethylsilyloxy-1,1,1,2,2-pentafluoro-N,N,4,4,5-pentamethylhexan-3-amine.
| Compound Name | 3-dimethylsilyloxy-1,1,1,2,2-pentafluoro-N,N,4,4,5-pentamethylhexan-3-amine |
|---|---|
| PubChem CID | 152743593 |
| Molecular Formula | C13H26F5NOSi |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 3-dimethylsilyloxy-1,1,1,2,2-pentafluoro-N,N,4,4,5-pentamethylhexan-3-amine |
| SMILES | CC(C)C(C)(C)C(O[SiH](C)C)(N(C)C)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H26F5NOSi/c1-9(2)10(3,4)12(19(5)6,20-21(7)8)11(14,15)13(16,17)18/h9,21H,1-8H3 |
| InChIKey | QQNAMGVOYJBYAO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|