C13H26Cl2F3NOSi — CID 152743650
2,2-dichloro-3-dimethylsilyloxy-1,1,1-trifluoro-N,N,4,4,5-pentamethylhexan-3-amine (PubChem CID 152743650) has the molecular formula C13H26Cl2F3NOSi and a molecular weight of 368.34 g/mol. Its IUPAC name is 2,2-dichloro-3-dimethylsilyloxy-1,1,1-trifluoro-N,N,4,4,5-pentamethylhexan-3-amine.
| Compound Name | 2,2-dichloro-3-dimethylsilyloxy-1,1,1-trifluoro-N,N,4,4,5-pentamethylhexan-3-amine |
|---|---|
| PubChem CID | 152743650 |
| Molecular Formula | C13H26Cl2F3NOSi |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2,2-dichloro-3-dimethylsilyloxy-1,1,1-trifluoro-N,N,4,4,5-pentamethylhexan-3-amine |
| SMILES | CC(C)C(C)(C)C(O[SiH](C)C)(N(C)C)C(Cl)(Cl)C(F)(F)F |
| InChI | InChI=1S/C13H26Cl2F3NOSi/c1-9(2)10(3,4)12(19(5)6,20-21(7)8)11(14,15)13(16,17)18/h9,21H,1-8H3 |
| InChIKey | ATRJGCQJPPBKMH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|