C10H26OSi2 — CID 123565630
(3-dimethylsilyloxy-3-methylbutan-2-yl)-trimethylsilane (PubChem CID 123565630) has the molecular formula C10H26OSi2 and a molecular weight of 218.49 g/mol. Its IUPAC name is (3-dimethylsilyloxy-3-methylbutan-2-yl)-trimethylsilane.
| Compound Name | (3-dimethylsilyloxy-3-methylbutan-2-yl)-trimethylsilane |
|---|---|
| PubChem CID | 123565630 |
| Molecular Formula | C10H26OSi2 |
| Molecular Weight | 218.49 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | (3-dimethylsilyloxy-3-methylbutan-2-yl)-trimethylsilane |
| SMILES | CC(C(C)(C)O[SiH](C)C)[Si](C)(C)C |
| InChI | InChI=1S/C10H26OSi2/c1-9(13(6,7)8)10(2,3)11-12(4)5/h9,12H,1-8H3 |
| InChIKey | SSXZOYDIYDRCFD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|