C14H38O4Si4 — CID 58280853
dimethyl-[2,4,5-tris(dimethylsilyloxy)hexan-3-yloxy]silane (PubChem CID 58280853) has the molecular formula C14H38O4Si4 and a molecular weight of 382.80 g/mol. Its IUPAC name is dimethyl-[2,4,5-tris(dimethylsilyloxy)hexan-3-yloxy]silane.
| Compound Name | dimethyl-[2,4,5-tris(dimethylsilyloxy)hexan-3-yloxy]silane |
|---|---|
| PubChem CID | 58280853 |
| Molecular Formula | C14H38O4Si4 |
| Molecular Weight | 382.80 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | dimethyl-[2,4,5-tris(dimethylsilyloxy)hexan-3-yloxy]silane |
| SMILES | CC(O[SiH](C)C)C(O[SiH](C)C)C(O[SiH](C)C)C(C)O[SiH](C)C |
| InChI | InChI=1S/C14H38O4Si4/c1-11(15-19(3)4)13(17-21(7)8)14(18-22(9)10)12(2)16-20(5)6/h11-14,19-22H,1-10H3 |
| InChIKey | SYOVFBRMMGASHC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.80 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|