C11H26O2Si — CID 173123768
(1S)-1-dimethylsilyloxy-3,3-dimethyl-2-propan-2-ylbutan-1-ol (PubChem CID 173123768) has the molecular formula C11H26O2Si and a molecular weight of 218.41 g/mol. Its IUPAC name is (1S)-1-dimethylsilyloxy-3,3-dimethyl-2-propan-2-ylbutan-1-ol.
| Compound Name | (1S)-1-dimethylsilyloxy-3,3-dimethyl-2-propan-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 173123768 |
| Molecular Formula | C11H26O2Si |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (1S)-1-dimethylsilyloxy-3,3-dimethyl-2-propan-2-ylbutan-1-ol |
| SMILES | CC(C)C([C@@H](O)O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C11H26O2Si/c1-8(2)9(11(3,4)5)10(12)13-14(6)7/h8-10,12,14H,1-7H3/t9?,10-/m0/s1 |
| InChIKey | HIXSUTPMOBVKLO-AXDSSHIGSA-N |
| XLogP | 2.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|