C10H20O2Si — CID 173343952
4-dimethylsilyloxy-5,5-dimethylhex-1-en-3-one (PubChem CID 173343952) has the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. Its IUPAC name is 4-dimethylsilyloxy-5,5-dimethylhex-1-en-3-one.
| Compound Name | 4-dimethylsilyloxy-5,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 173343952 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 4-dimethylsilyloxy-5,5-dimethylhex-1-en-3-one |
| SMILES | C=CC(=O)C(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C10H20O2Si/c1-7-8(11)9(10(2,3)4)12-13(5)6/h7,9,13H,1H2,2-6H3 |
| InChIKey | JPTKVQWPBBHSRL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|