C9H15NO — CID 123444398
4-methanimidoyl-5,5-dimethylhex-1-en-3-one (PubChem CID 123444398) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-methanimidoyl-5,5-dimethylhex-1-en-3-one.
| Compound Name | 4-methanimidoyl-5,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 123444398 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-methanimidoyl-5,5-dimethylhex-1-en-3-one |
| SMILES | [H]/N=C/C(C(=O)C=C)C(C)(C)C |
| InChI | InChI=1S/C9H15NO/c1-5-8(11)7(6-10)9(2,3)4/h5-7,10H,1H2,2-4H3/b10-6+ |
| InChIKey | JVILQRNUHYPIFR-UXBLZVDNSA-N |
| XLogP | 2.05 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|