C9H20O2Si — CID 173030101
3-dimethylsilyloxy-4,4-dimethylpentan-2-one (PubChem CID 173030101) has the molecular formula C9H20O2Si and a molecular weight of 188.34 g/mol. Its IUPAC name is 3-dimethylsilyloxy-4,4-dimethylpentan-2-one.
| Compound Name | 3-dimethylsilyloxy-4,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 173030101 |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-dimethylsilyloxy-4,4-dimethylpentan-2-one |
| SMILES | CC(=O)C(O[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C9H20O2Si/c1-7(10)8(9(2,3)4)11-12(5)6/h8,12H,1-6H3 |
| InChIKey | OMZFIBUJCRYVKN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|