C22H41NO3Si2 — CID 175220794
N-[3,5-bis(1-dimethylsilyloxy-2,2-dimethylpropyl)phenyl]acetamide (PubChem CID 175220794) has the molecular formula C22H41NO3Si2 and a molecular weight of 423.75 g/mol. Its IUPAC name is N-[3,5-bis(1-dimethylsilyloxy-2,2-dimethylpropyl)phenyl]acetamide.
| Compound Name | N-[3,5-bis(1-dimethylsilyloxy-2,2-dimethylpropyl)phenyl]acetamide |
|---|---|
| PubChem CID | 175220794 |
| Molecular Formula | C22H41NO3Si2 |
| Molecular Weight | 423.75 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | N-[3,5-bis(1-dimethylsilyloxy-2,2-dimethylpropyl)phenyl]acetamide |
| SMILES | CC(=O)Nc1cc(C(O[SiH](C)C)C(C)(C)C)cc(C(O[SiH](C)C)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H41NO3Si2/c1-15(24)23-18-13-16(19(21(2,3)4)25-27(8)9)12-17(14-18)20(22(5,6)7)26-28(10)11/h12-14,19-20,27-28H,1-11H3,(H,23,24) |
| InChIKey | AZCSNUZCSMJOGX-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.75 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|