C15H24O3Si — CID 91999158
2-[4-(1-dimethylsilyloxy-2,2-dimethylpropyl)phenyl]acetic acid (PubChem CID 91999158) has the molecular formula C15H24O3Si and a molecular weight of 280.44 g/mol. Its IUPAC name is 2-[4-(1-dimethylsilyloxy-2,2-dimethylpropyl)phenyl]acetic acid.
| Compound Name | 2-[4-(1-dimethylsilyloxy-2,2-dimethylpropyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 91999158 |
| Molecular Formula | C15H24O3Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 2-[4-(1-dimethylsilyloxy-2,2-dimethylpropyl)phenyl]acetic acid |
| SMILES | C[SiH](C)OC(c1ccc(CC(=O)O)cc1)C(C)(C)C |
| InChI | InChI=1S/C15H24O3Si/c1-15(2,3)14(18-19(4)5)12-8-6-11(7-9-12)10-13(16)17/h6-9,14,19H,10H2,1-5H3,(H,16,17) |
| InChIKey | FDHXASLWGQXPJB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|