C18H30O3Si — CID 173046450
2-[4-(1-dimethylsilyloxy-5,5-dimethylhexyl)phenyl]acetic acid (PubChem CID 173046450) has the molecular formula C18H30O3Si and a molecular weight of 322.52 g/mol. Its IUPAC name is 2-[4-(1-dimethylsilyloxy-5,5-dimethylhexyl)phenyl]acetic acid.
| Compound Name | 2-[4-(1-dimethylsilyloxy-5,5-dimethylhexyl)phenyl]acetic acid |
|---|---|
| PubChem CID | 173046450 |
| Molecular Formula | C18H30O3Si |
| Molecular Weight | 322.52 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | 2-[4-(1-dimethylsilyloxy-5,5-dimethylhexyl)phenyl]acetic acid |
| SMILES | C[SiH](C)OC(CCCC(C)(C)C)c1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C18H30O3Si/c1-18(2,3)12-6-7-16(21-22(4)5)15-10-8-14(9-11-15)13-17(19)20/h8-11,16,22H,6-7,12-13H2,1-5H3,(H,19,20) |
| InChIKey | XMMWSBVHPUALRP-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|