C15H21FO3 — CID 142297392
2-[4-(3-fluoro-2-hydroxy-2-methylhexan-3-yl)phenyl]acetic acid (PubChem CID 142297392) has the molecular formula C15H21FO3 and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-[4-(3-fluoro-2-hydroxy-2-methylhexan-3-yl)phenyl]acetic acid.
| Compound Name | 2-[4-(3-fluoro-2-hydroxy-2-methylhexan-3-yl)phenyl]acetic acid |
|---|---|
| PubChem CID | 142297392 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-[4-(3-fluoro-2-hydroxy-2-methylhexan-3-yl)phenyl]acetic acid |
| SMILES | CCCC(F)(c1ccc(CC(=O)O)cc1)C(C)(C)O |
| InChI | InChI=1S/C15H21FO3/c1-4-9-15(16,14(2,3)19)12-7-5-11(6-8-12)10-13(17)18/h5-8,19H,4,9-10H2,1-3H3,(H,17,18) |
| InChIKey | GQMOJZBUDPDRSG-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |