C11H26O4SSi — CID 173419817
1-dimethylsilyloxy-6,6-dimethylheptane-1-sulfonic acid (PubChem CID 173419817) has the molecular formula C11H26O4SSi and a molecular weight of 282.48 g/mol. Its IUPAC name is 1-dimethylsilyloxy-6,6-dimethylheptane-1-sulfonic acid.
| Compound Name | 1-dimethylsilyloxy-6,6-dimethylheptane-1-sulfonic acid |
|---|---|
| PubChem CID | 173419817 |
| Molecular Formula | C11H26O4SSi |
| Molecular Weight | 282.48 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 1-dimethylsilyloxy-6,6-dimethylheptane-1-sulfonic acid |
| SMILES | C[SiH](C)OC(CCCCC(C)(C)C)S(=O)(=O)O |
| InChI | InChI=1S/C11H26O4SSi/c1-11(2,3)9-7-6-8-10(15-17(4)5)16(12,13)14/h10,17H,6-9H2,1-5H3,(H,12,13,14) |
| InChIKey | ICSFLXAVMPWSKE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|