(5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid

C16H34O3Si — CID 123871639

IUPAC(5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid
SMILESC[C@@H](CCC(C(=O)O)(C(C)(C)C)C(C)(C)C)O[SiH](C)C
InChIInChI=1S/C16H34O3Si/c1-12(19-20(8)9)10-11-16(13(17)18,14(2,3)4)15(5,6)7/h12,20H,10-11H2,1-9H3,(H,17,18)/t12-/m0/s1
InChIKeyBTRJXKXUZRADJH-LBPRGKRZSA-N
MW302.53 g/mol
LogP4.32
Rot. Bonds6

About (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid

(5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid (PubChem CID 123871639) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid.

Molecular Properties

Compound Name(5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid
PubChem CID123871639
Molecular FormulaC16H34O3Si
Molecular Weight302.53 g/mol
Exact Mass302.23
IUPAC Name(5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid
SMILESC[C@@H](CCC(C(=O)O)(C(C)(C)C)C(C)(C)C)O[SiH](C)C
InChIInChI=1S/C16H34O3Si/c1-12(19-20(8)9)10-11-16(13(17)18,14(2,3)4)15(5,6)7/h12,20H,10-11H2,1-9H3,(H,17,18)/t12-/m0/s1
InChIKeyBTRJXKXUZRADJH-LBPRGKRZSA-N
XLogP4.32
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.53
LogP ≤ 54.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid?
The IUPAC name of (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid (CID 123871639) is (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid.
What is the SMILES notation for (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid?
The canonical SMILES for (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid is C[C@@H](CCC(C(=O)O)(C(C)(C)C)C(C)(C)C)O[SiH](C)C.
What is the InChIKey of (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid?
The InChIKey is BTRJXKXUZRADJH-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H34O3Si/c1-12(19-20(8)9)10-11-16(13(17)18,14(2,3)4)15(5,6)7/h12,20H,10-11H2,1-9H3,(H,17,18)/t12-/m0/s1.
What are the key properties of (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid?
(5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid has a molecular weight of 302.53 g/mol, XLogP of 4.32, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid is sourced from PubChem (CID 123871639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).