C16H34O3Si — CID 123871639
(5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid (PubChem CID 123871639) has the molecular formula C16H34O3Si and a molecular weight of 302.53 g/mol. Its IUPAC name is (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid.
| Compound Name | (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid |
|---|---|
| PubChem CID | 123871639 |
| Molecular Formula | C16H34O3Si |
| Molecular Weight | 302.53 g/mol |
| Exact Mass | 302.23 |
| IUPAC Name | (5S)-2,2-ditert-butyl-5-dimethylsilyloxyhexanoic acid |
| SMILES | C[C@@H](CCC(C(=O)O)(C(C)(C)C)C(C)(C)C)O[SiH](C)C |
| InChI | InChI=1S/C16H34O3Si/c1-12(19-20(8)9)10-11-16(13(17)18,14(2,3)4)15(5,6)7/h12,20H,10-11H2,1-9H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | BTRJXKXUZRADJH-LBPRGKRZSA-N |
| XLogP | 4.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|