C14H28O2 — CID 123233538
2-tert-butyl-2,5,6-trimethylheptanoic acid (PubChem CID 123233538) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2-tert-butyl-2,5,6-trimethylheptanoic acid.
| Compound Name | 2-tert-butyl-2,5,6-trimethylheptanoic acid |
|---|---|
| PubChem CID | 123233538 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2-tert-butyl-2,5,6-trimethylheptanoic acid |
| SMILES | CC(C)C(C)CCC(C)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-10(2)11(3)8-9-14(7,12(15)16)13(4,5)6/h10-11H,8-9H2,1-7H3,(H,15,16) |
| InChIKey | GUKIAUNLSZOBTO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |