C5H5F6O4P — CID 87919147
2-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 87919147) has the molecular formula C5H5F6O4P and a molecular weight of 274.05 g/mol. Its IUPAC name is 2-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 87919147 |
| Molecular Formula | C5H5F6O4P |
| Molecular Weight | 274.05 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 2-(1,1,1,2,3,3-hexafluoropropan-2-yloxy)-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | O=P1(OC(F)(C(F)F)C(F)(F)F)OCCO1 |
| InChI | InChI=1S/C5H5F6O4P/c6-3(7)4(8,5(9,10)11)15-16(12)13-1-2-14-16/h3H,1-2H2 |
| InChIKey | WXPXXFXXOHRMMF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.05 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|