C10H23O5PSi — CID 173329753
[3,3-dimethyl-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]butan-2-yl]oxy-dimethylsilane (PubChem CID 173329753) has the molecular formula C10H23O5PSi and a molecular weight of 282.35 g/mol. Its IUPAC name is [3,3-dimethyl-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]butan-2-yl]oxy-dimethylsilane.
| Compound Name | [3,3-dimethyl-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]butan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 173329753 |
| Molecular Formula | C10H23O5PSi |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [3,3-dimethyl-1-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]butan-2-yl]oxy-dimethylsilane |
| SMILES | C[SiH](C)OC(COP1(=O)OCCO1)C(C)(C)C |
| InChI | InChI=1S/C10H23O5PSi/c1-10(2,3)9(15-17(4)5)8-14-16(11)12-6-7-13-16/h9,17H,6-8H2,1-5H3 |
| InChIKey | NNFKSWONZMWJKD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|