C4H9O5P — CID 59760775
2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethanol (PubChem CID 59760775) has the molecular formula C4H9O5P and a molecular weight of 168.08 g/mol. Its IUPAC name is 2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethanol.
| Compound Name | 2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethanol |
|---|---|
| PubChem CID | 59760775 |
| Molecular Formula | C4H9O5P |
| Molecular Weight | 168.08 g/mol |
| Exact Mass | 168.02 |
| IUPAC Name | 2-[(2-oxo-1,3,2λ5-dioxaphospholan-2-yl)oxy]ethanol |
| SMILES | O=P1(OCCO)OCCO1 |
| InChI | InChI=1S/C4H9O5P/c5-1-2-7-10(6)8-3-4-9-10/h5H,1-4H2 |
| InChIKey | RDSRAAJTBNSZMM-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.08 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|