C6H13O4PS — CID 169097412
2-(3-methylsulfanylpropoxy)-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 169097412) has the molecular formula C6H13O4PS and a molecular weight of 212.21 g/mol. Its IUPAC name is 2-(3-methylsulfanylpropoxy)-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-(3-methylsulfanylpropoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 169097412 |
| Molecular Formula | C6H13O4PS |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2-(3-methylsulfanylpropoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CSCCCOP1(=O)OCCO1 |
| InChI | InChI=1S/C6H13O4PS/c1-12-6-2-3-8-11(7)9-4-5-10-11/h2-6H2,1H3 |
| InChIKey | NZEKHBNMKKVJRR-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|