C13H21O4P — CID 118066349
(1S,2S,8R,9R)-5-butoxy-4,6-dioxa-5λ5-phosphatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide (PubChem CID 118066349) has the molecular formula C13H21O4P and a molecular weight of 272.28 g/mol. Its IUPAC name is (1S,2S,8R,9R)-5-butoxy-4,6-dioxa-5λ5-phosphatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide.
| Compound Name | (1S,2S,8R,9R)-5-butoxy-4,6-dioxa-5λ5-phosphatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide |
|---|---|
| PubChem CID | 118066349 |
| Molecular Formula | C13H21O4P |
| Molecular Weight | 272.28 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (1S,2S,8R,9R)-5-butoxy-4,6-dioxa-5λ5-phosphatricyclo[7.2.1.02,8]dodec-10-ene 5-oxide |
| SMILES | CCCCOP1(=O)OC[C@@H]2[C@H](CO1)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C13H21O4P/c1-2-3-6-15-18(14)16-8-12-10-4-5-11(7-10)13(12)9-17-18/h4-5,10-13H,2-3,6-9H2,1H3/t10-,11+,12+,13-,18? |
| InChIKey | JQOCHFJUOHYURM-ZUWJSYCLSA-N |
| XLogP | 3.40 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|