C12H25O2P — CID 566357
1-butoxy-2,2,3,4,4-pentamethyl-1lambda5-phosphetane 1-oxide (PubChem CID 566357) has the molecular formula C12H25O2P and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-butoxy-2,2,3,4,4-pentamethyl-1lambda5-phosphetane 1-oxide.
| Compound Name | 1-butoxy-2,2,3,4,4-pentamethyl-1lambda5-phosphetane 1-oxide |
|---|---|
| PubChem CID | 566357 |
| Molecular Formula | C12H25O2P |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-butoxy-2,2,3,4,4-pentamethyl-1lambda5-phosphetane 1-oxide |
| SMILES | CCCCOP1(=O)C(C)(C)C(C)C1(C)C |
| InChI | InChI=1S/C12H25O2P/c1-7-8-9-14-15(13)11(3,4)10(2)12(15,5)6/h10H,7-9H2,1-6H3 |
| InChIKey | UQSKZHRRQUGXDF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|