C8H17O4P — CID 123874175
2-(4-methylpentoxy)-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 123874175) has the molecular formula C8H17O4P and a molecular weight of 208.19 g/mol. Its IUPAC name is 2-(4-methylpentoxy)-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-(4-methylpentoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 123874175 |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-(4-methylpentoxy)-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CC(C)CCCOP1(=O)OCCO1 |
| InChI | InChI=1S/C8H17O4P/c1-8(2)4-3-5-10-13(9)11-6-7-12-13/h8H,3-7H2,1-2H3 |
| InChIKey | DAMXXPGHTZHZMY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|