About 3-methylsulfanylpropyl carbonochloridate
3-methylsulfanylpropyl carbonochloridate (PubChem CID 131162279) has the molecular formula C5H9ClO2S
and a molecular weight of 168.64 g/mol. Its IUPAC name is 3-methylsulfanylpropyl carbonochloridate.
Molecular Properties
| Compound Name | 3-methylsulfanylpropyl carbonochloridate |
| PubChem CID | 131162279 |
| Molecular Formula | C5H9ClO2S |
| Molecular Weight | 168.64 g/mol |
| Exact Mass | 168.00 |
| IUPAC Name | 3-methylsulfanylpropyl carbonochloridate |
| SMILES | CSCCCOC(=O)Cl |
| InChI | InChI=1S/C5H9ClO2S/c1-9-4-2-3-8-5(6)7/h2-4H2,1H3 |
| InChIKey | LNNQZILFEGZMEB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.64 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfanylpropyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanylpropyl carbonochloridate?
The IUPAC name of 3-methylsulfanylpropyl carbonochloridate (CID 131162279) is 3-methylsulfanylpropyl carbonochloridate.
What is the SMILES notation for 3-methylsulfanylpropyl carbonochloridate?
The canonical SMILES for 3-methylsulfanylpropyl carbonochloridate is CSCCCOC(=O)Cl.
What is the InChIKey of 3-methylsulfanylpropyl carbonochloridate?
The InChIKey is LNNQZILFEGZMEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO2S/c1-9-4-2-3-8-5(6)7/h2-4H2,1H3.
What are the key properties of 3-methylsulfanylpropyl carbonochloridate?
3-methylsulfanylpropyl carbonochloridate has a molecular weight of 168.64 g/mol, XLogP of 2.11, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanylpropyl carbonochloridate is sourced from PubChem (CID 131162279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).