C14H30O10P2 — CID 160853241
2,2-dimethyl-3-[(2-oxo-1,4,2λ5-dioxaphosphinan-2-yl)oxy]propan-1-ol;2-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol (PubChem CID 160853241) has the molecular formula C14H30O10P2 and a molecular weight of 420.33 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(2-oxo-1,4,2λ5-dioxaphosphinan-2-yl)oxy]propan-1-ol;2-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol.
| Compound Name | 2,2-dimethyl-3-[(2-oxo-1,4,2λ5-dioxaphosphinan-2-yl)oxy]propan-1-ol;2-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol |
|---|---|
| PubChem CID | 160853241 |
| Molecular Formula | C14H30O10P2 |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | 2,2-dimethyl-3-[(2-oxo-1,4,2λ5-dioxaphosphinan-2-yl)oxy]propan-1-ol;2-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methoxy]ethanol |
| SMILES | CC(C)(CO)COP1(=O)COCCO1.O=P1(COCCO)OCCCO1 |
| InChI | InChI=1S/C8H17O5P.C6H13O5P/c1-8(2,5-9)6-13-14(10)7-11-3-4-12-14;7-2-5-9-6-12(8)10-3-1-4-11-12/h9H,3-7H2,1-2H3;7H,1-6H2 |
| InChIKey | SJNPVPBNMWPOGB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|