C9H15O6P — CID 175502794
2-hydroxyethyl 2-methyl-3-(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)prop-2-enoate (PubChem CID 175502794) has the molecular formula C9H15O6P and a molecular weight of 250.19 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methyl-3-(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)prop-2-enoate.
| Compound Name | 2-hydroxyethyl 2-methyl-3-(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 175502794 |
| Molecular Formula | C9H15O6P |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-hydroxyethyl 2-methyl-3-(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)prop-2-enoate |
| SMILES | CC(=CP1(=O)OCCCO1)C(=O)OCCO |
| InChI | InChI=1S/C9H15O6P/c1-8(9(11)13-6-3-10)7-16(12)14-4-2-5-15-16/h7,10H,2-6H2,1H3 |
| InChIKey | XGDOSCQWFQSARZ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|