C8H12O4 — CID 90892829
2-hydroxyethyl 2-methyl-3-(oxiran-2-yl)prop-2-enoate (PubChem CID 90892829) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-hydroxyethyl 2-methyl-3-(oxiran-2-yl)prop-2-enoate.
| Compound Name | 2-hydroxyethyl 2-methyl-3-(oxiran-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 90892829 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-hydroxyethyl 2-methyl-3-(oxiran-2-yl)prop-2-enoate |
| SMILES | CC(=CC1CO1)C(=O)OCCO |
| InChI | InChI=1S/C8H12O4/c1-6(4-7-5-12-7)8(10)11-3-2-9/h4,7,9H,2-3,5H2,1H3 |
| InChIKey | ACDIYOGHEANEPS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|