C8H5F12U- — CID 159746826
1,1,1,2,3,4-hexafluoro-2,4-bis(trifluoromethyl)hexane;uranium (PubChem CID 159746826) has the molecular formula C8H5F12U- and a molecular weight of 567.13 g/mol. Its IUPAC name is 1,1,1,2,3,4-hexafluoro-2,4-bis(trifluoromethyl)hexane;uranium.
| Compound Name | 1,1,1,2,3,4-hexafluoro-2,4-bis(trifluoromethyl)hexane;uranium |
|---|---|
| PubChem CID | 159746826 |
| Molecular Formula | C8H5F12U- |
| Molecular Weight | 567.13 g/mol |
| Exact Mass | 567.07 |
| IUPAC Name | 1,1,1,2,3,4-hexafluoro-2,4-bis(trifluoromethyl)hexane;uranium |
| SMILES | [CH2-]CC(F)(C(F)C(F)(C(F)(F)F)C(F)(F)F)C(F)(F)F.[U] |
| InChI | InChI=1S/C8H5F12.U/c1-2-4(10,6(12,13)14)3(9)5(11,7(15,16)17)8(18,19)20;/h3H,1-2H2;/q-1; |
| InChIKey | URYHUAVWTIORFA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.13 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|