C7H6F10 — CID 54187869
2-(difluoromethyl)-1,1,1,2,5,5,6,6-octafluorohexane (PubChem CID 54187869) has the molecular formula C7H6F10 and a molecular weight of 280.10 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1,2,5,5,6,6-octafluorohexane.
| Compound Name | 2-(difluoromethyl)-1,1,1,2,5,5,6,6-octafluorohexane |
|---|---|
| PubChem CID | 54187869 |
| Molecular Formula | C7H6F10 |
| Molecular Weight | 280.10 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-(difluoromethyl)-1,1,1,2,5,5,6,6-octafluorohexane |
| SMILES | FC(F)C(F)(F)CCC(F)(C(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H6F10/c8-3(9)5(12,7(15,16)17)1-2-6(13,14)4(10)11/h3-4H,1-2H2 |
| InChIKey | CYKKUVSCQCUZAK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.10 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|