C6H2F12O2 — CID 87586527
2-(difluoromethoxy)-1,1,1,2,4,4,4-heptafluoro-3-(trifluoromethoxy)butane (PubChem CID 87586527) has the molecular formula C6H2F12O2 and a molecular weight of 334.06 g/mol. Its IUPAC name is 2-(difluoromethoxy)-1,1,1,2,4,4,4-heptafluoro-3-(trifluoromethoxy)butane.
| Compound Name | 2-(difluoromethoxy)-1,1,1,2,4,4,4-heptafluoro-3-(trifluoromethoxy)butane |
|---|---|
| PubChem CID | 87586527 |
| Molecular Formula | C6H2F12O2 |
| Molecular Weight | 334.06 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 2-(difluoromethoxy)-1,1,1,2,4,4,4-heptafluoro-3-(trifluoromethoxy)butane |
| SMILES | FC(F)OC(F)(C(OC(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F12O2/c7-2(8)20-3(9,5(13,14)15)1(4(10,11)12)19-6(16,17)18/h1-2H |
| InChIKey | PTWPPRBFNMMWEO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.06 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |