C9H4BF18NaO3 — CID 132774229
sodium tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)boranuide (PubChem CID 132774229) has the molecular formula C9H4BF18NaO3 and a molecular weight of 535.89 g/mol. Its IUPAC name is sodium tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)boranuide.
| Compound Name | sodium tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)boranuide |
|---|---|
| PubChem CID | 132774229 |
| Molecular Formula | C9H4BF18NaO3 |
| Molecular Weight | 535.89 g/mol |
| Exact Mass | 535.99 |
| IUPAC Name | sodium tris(1,1,1,3,3,3-hexafluoropropan-2-yloxy)boranuide |
| SMILES | FC(F)(F)C(O[BH-](OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C9H4BF18O3.Na/c11-4(12,13)1(5(14,15)16)29-10(30-2(6(17,18)19)7(20,21)22)31-3(8(23,24)25)9(26,27)28;/h1-3,10H;/q-1;+1 |
| InChIKey | DTZIXNVCFBZIGP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.89 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|