C5H3F9O2 — CID 86050515
2,2,2-trifluoro-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanol (PubChem CID 86050515) has the molecular formula C5H3F9O2 and a molecular weight of 266.06 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanol |
|---|---|
| PubChem CID | 86050515 |
| Molecular Formula | C5H3F9O2 |
| Molecular Weight | 266.06 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | 2,2,2-trifluoro-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)ethanol |
| SMILES | OC(OC(C(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9O2/c6-3(7,8)1(4(9,10)11)16-2(15)5(12,13)14/h1-2,15H |
| InChIKey | SNXJPAYNJFGNNJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.06 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|