C12H20F6O2 — CID 149237308
2-ethyl-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,3,3-trimethylbutan-1-ol (PubChem CID 149237308) has the molecular formula C12H20F6O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is 2-ethyl-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,3,3-trimethylbutan-1-ol.
| Compound Name | 2-ethyl-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,3,3-trimethylbutan-1-ol |
|---|---|
| PubChem CID | 149237308 |
| Molecular Formula | C12H20F6O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-ethyl-1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,3,3-trimethylbutan-1-ol |
| SMILES | CCC(C)(C(O)OC(C(F)(F)F)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C12H20F6O2/c1-6-10(5,9(2,3)4)8(19)20-7(11(13,14)15)12(16,17)18/h7-8,19H,6H2,1-5H3 |
| InChIKey | XLMBPAHIGGHSLI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|