C23H44F12N4O2P2+2 — CID 6397662
[bis(diethylamino)-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphaniumyl]methyl-bis(diethylamino)-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphanium (PubChem CID 6397662) has the molecular formula C23H44F12N4O2P2+2 and a molecular weight of 698.56 g/mol. Its IUPAC name is [bis(diethylamino)-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphaniumyl]methyl-bis(diethylamino)-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphanium.
| Compound Name | [bis(diethylamino)-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphaniumyl]methyl-bis(diethylamino)-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphanium |
|---|---|
| PubChem CID | 6397662 |
| Molecular Formula | C23H44F12N4O2P2+2 |
| Molecular Weight | 698.56 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | [bis(diethylamino)-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphaniumyl]methyl-bis(diethylamino)-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphanium |
| SMILES | CCN(CC)[P+](C[P+](OC(C(F)(F)F)C(F)(F)F)(N(CC)CC)N(CC)CC)(OC(C(F)(F)F)C(F)(F)F)N(CC)CC |
| InChI | InChI=1S/C23H44F12N4O2P2/c1-9-36(10-2)42(37(11-3)12-4,40-18(20(24,25)26)21(27,28)29)17-43(38(13-5)14-6,39(15-7)16-8)41-19(22(30,31)32)23(33,34)35/h18-19H,9-17H2,1-8H3/q+2 |
| InChIKey | AWJDMEHOEOVDNJ-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 31.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.56 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|