C12H20F6OS — CID 102723593
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-2-propylpentane-1-thiol (PubChem CID 102723593) has the molecular formula C12H20F6OS and a molecular weight of 326.35 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-2-propylpentane-1-thiol.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-2-propylpentane-1-thiol |
|---|---|
| PubChem CID | 102723593 |
| Molecular Formula | C12H20F6OS |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethyl)-2-propylpentane-1-thiol |
| SMILES | CCCC(CS)(CCC)COC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H20F6OS/c1-3-5-10(8-20,6-4-2)7-19-9(11(13,14)15)12(16,17)18/h9,20H,3-8H2,1-2H3 |
| InChIKey | ZFKFBBHVFONBMO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|