C12H23F3OS — CID 82958276
2-propyl-2-(3,3,3-trifluoropropoxymethyl)pentane-1-thiol (PubChem CID 82958276) has the molecular formula C12H23F3OS and a molecular weight of 272.38 g/mol. Its IUPAC name is 2-propyl-2-(3,3,3-trifluoropropoxymethyl)pentane-1-thiol.
| Compound Name | 2-propyl-2-(3,3,3-trifluoropropoxymethyl)pentane-1-thiol |
|---|---|
| PubChem CID | 82958276 |
| Molecular Formula | C12H23F3OS |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-propyl-2-(3,3,3-trifluoropropoxymethyl)pentane-1-thiol |
| SMILES | CCCC(CS)(CCC)COCCC(F)(F)F |
| InChI | InChI=1S/C12H23F3OS/c1-3-5-11(10-17,6-4-2)9-16-8-7-12(13,14)15/h17H,3-10H2,1-2H3 |
| InChIKey | LQDUHLCDGLKERO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|