C11H22F3NO3S — CID 82794784
2-ethyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide (PubChem CID 82794784) has the molecular formula C11H22F3NO3S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-ethyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide.
| Compound Name | 2-ethyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 82794784 |
| Molecular Formula | C11H22F3NO3S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-ethyl-2-(4,4,4-trifluorobutoxymethyl)butane-1-sulfonamide |
| SMILES | CCC(CC)(COCCCC(F)(F)F)CS(N)(=O)=O |
| InChI | InChI=1S/C11H22F3NO3S/c1-3-10(4-2,9-19(15,16)17)8-18-7-5-6-11(12,13)14/h3-9H2,1-2H3,(H2,15,16,17) |
| InChIKey | PGHFQQDKGAVEAY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|