C10H15F6NO3 — CID 138480552
1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-morpholin-4-ylpropan-1-ol (PubChem CID 138480552) has the molecular formula C10H15F6NO3 and a molecular weight of 311.22 g/mol. Its IUPAC name is 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-morpholin-4-ylpropan-1-ol.
| Compound Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-morpholin-4-ylpropan-1-ol |
|---|---|
| PubChem CID | 138480552 |
| Molecular Formula | C10H15F6NO3 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-3-morpholin-4-ylpropan-1-ol |
| SMILES | OC(CCN1CCOCC1)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H15F6NO3/c11-9(12,13)8(10(14,15)16)20-7(18)1-2-17-3-5-19-6-4-17/h7-8,18H,1-6H2 |
| InChIKey | ABUDNLYLWWAIKJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|