C13H14Cl2O4 — CID 11522358
4-[1-(3,4-dichlorophenyl)propan-2-yloxy]-4-oxobutanoic acid (PubChem CID 11522358) has the molecular formula C13H14Cl2O4 and a molecular weight of 305.16 g/mol. Its IUPAC name is 4-[1-(3,4-dichlorophenyl)propan-2-yloxy]-4-oxobutanoic acid.
| Compound Name | 4-[1-(3,4-dichlorophenyl)propan-2-yloxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 11522358 |
| Molecular Formula | C13H14Cl2O4 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 4-[1-(3,4-dichlorophenyl)propan-2-yloxy]-4-oxobutanoic acid |
| SMILES | CC(Cc1ccc(Cl)c(Cl)c1)OC(=O)CCC(=O)O |
| InChI | InChI=1S/C13H14Cl2O4/c1-8(19-13(18)5-4-12(16)17)6-9-2-3-10(14)11(15)7-9/h2-3,7-8H,4-6H2,1H3,(H,16,17) |
| InChIKey | TWYFGCDIAHQWCC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |