C17H18F3NO4 — CID 11523288
(4S)-4-benzyl-3-[(E,2S,3S)-3-hydroxy-2-(trifluoromethyl)hex-4-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11523288) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(E,2S,3S)-3-hydroxy-2-(trifluoromethyl)hex-4-enoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(E,2S,3S)-3-hydroxy-2-(trifluoromethyl)hex-4-enoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11523288 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (4S)-4-benzyl-3-[(E,2S,3S)-3-hydroxy-2-(trifluoromethyl)hex-4-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C/C=C/[C@H](O)[C@@H](C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO4/c1-2-6-13(22)14(17(18,19)20)15(23)21-12(10-25-16(21)24)9-11-7-4-3-5-8-11/h2-8,12-14,22H,9-10H2,1H3/b6-2+/t12-,13-,14-/m0/s1 |
| InChIKey | SIIGAPRNEQSWHI-JTJRXBNKSA-N |
| XLogP | 2.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|