C20H14N4O5 — CID 11523955
(E)-3-(furan-2-yl)-N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]prop-2-enamide (PubChem CID 11523955) has the molecular formula C20H14N4O5 and a molecular weight of 390.36 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11523955 |
| Molecular Formula | C20H14N4O5 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccco1)Nc1ccc(-c2nc3ccc([N+](=O)[O-])cc3n2O)cc1 |
| InChI | InChI=1S/C20H14N4O5/c25-19(10-8-16-2-1-11-29-16)21-14-5-3-13(4-6-14)20-22-17-9-7-15(24(27)28)12-18(17)23(20)26/h1-12,26H,(H,21,25)/b10-8+ |
| InChIKey | XFKFBWOYPGXYMR-CSKARUKUSA-N |
| XLogP | 4.09 |
| TPSA | 123.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|