C23H15N5O4 — CID 11711564
(E)-3-(4-cyanophenyl)-N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]prop-2-enamide (PubChem CID 11711564) has the molecular formula C23H15N5O4 and a molecular weight of 425.40 g/mol. Its IUPAC name is (E)-3-(4-cyanophenyl)-N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-cyanophenyl)-N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 11711564 |
| Molecular Formula | C23H15N5O4 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (E)-3-(4-cyanophenyl)-N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]prop-2-enamide |
| SMILES | N#Cc1ccc(/C=C/C(=O)Nc2ccc(-c3nc4ccc([N+](=O)[O-])cc4n3O)cc2)cc1 |
| InChI | InChI=1S/C23H15N5O4/c24-14-16-3-1-15(2-4-16)5-12-22(29)25-18-8-6-17(7-9-18)23-26-20-11-10-19(28(31)32)13-21(20)27(23)30/h1-13,30H,(H,25,29)/b12-5+ |
| InChIKey | FDNBRUPZXDMACL-LFYBBSHMSA-N |
| XLogP | 4.37 |
| TPSA | 134.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|