C23H16FN3O4 — CID 67068824
2-[4-[3-(4-fluorophenyl)prop-2-enoylamino]phenyl]-3-hydroxybenzimidazole-5-carboxylic acid (PubChem CID 67068824) has the molecular formula C23H16FN3O4 and a molecular weight of 417.40 g/mol. Its IUPAC name is 2-[4-[3-(4-fluorophenyl)prop-2-enoylamino]phenyl]-3-hydroxybenzimidazole-5-carboxylic acid.
| Compound Name | 2-[4-[3-(4-fluorophenyl)prop-2-enoylamino]phenyl]-3-hydroxybenzimidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 67068824 |
| Molecular Formula | C23H16FN3O4 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 2-[4-[3-(4-fluorophenyl)prop-2-enoylamino]phenyl]-3-hydroxybenzimidazole-5-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(F)cc1)Nc1ccc(-c2nc3ccc(C(=O)O)cc3n2O)cc1 |
| InChI | InChI=1S/C23H16FN3O4/c24-17-7-1-14(2-8-17)3-12-21(28)25-18-9-4-15(5-10-18)22-26-19-11-6-16(23(29)30)13-20(19)27(22)31/h1-13,31H,(H,25,28)(H,29,30) |
| InChIKey | AZGWRQIZVURLAA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|