C23H18N4O4 — CID 73024051
N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 73024051) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 73024051 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | N-[4-(1-hydroxy-6-nitrobenzimidazol-2-yl)phenyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2ccc(-c3nc4ccc([N+](=O)[O-])cc4n3O)cc2)cc1 |
| InChI | InChI=1S/C23H18N4O4/c1-15-2-4-16(5-3-15)6-13-22(28)24-18-9-7-17(8-10-18)23-25-20-12-11-19(27(30)31)14-21(20)26(23)29/h2-14,29H,1H3,(H,24,28) |
| InChIKey | MINCGYPEMCVSCT-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|