C26H20N4O7 — CID 67068817
2-[2-[4-[3-(4-acetylphenyl)prop-2-enoylamino]phenyl]-1-hydroxy-6-nitrobenzimidazol-4-yl]acetic acid (PubChem CID 67068817) has the molecular formula C26H20N4O7 and a molecular weight of 500.47 g/mol. Its IUPAC name is 2-[2-[4-[3-(4-acetylphenyl)prop-2-enoylamino]phenyl]-1-hydroxy-6-nitrobenzimidazol-4-yl]acetic acid.
| Compound Name | 2-[2-[4-[3-(4-acetylphenyl)prop-2-enoylamino]phenyl]-1-hydroxy-6-nitrobenzimidazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 67068817 |
| Molecular Formula | C26H20N4O7 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | 2-[2-[4-[3-(4-acetylphenyl)prop-2-enoylamino]phenyl]-1-hydroxy-6-nitrobenzimidazol-4-yl]acetic acid |
| SMILES | CC(=O)c1ccc(C=CC(=O)Nc2ccc(-c3nc4c(CC(=O)O)cc([N+](=O)[O-])cc4n3O)cc2)cc1 |
| InChI | InChI=1S/C26H20N4O7/c1-15(31)17-5-2-16(3-6-17)4-11-23(32)27-20-9-7-18(8-10-20)26-28-25-19(13-24(33)34)12-21(30(36)37)14-22(25)29(26)35/h2-12,14,35H,13H2,1H3,(H,27,32)(H,33,34) |
| InChIKey | QPNOEIWVECUUQV-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 164.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|