C29H29FN6O5 — CID 25060842
(E)-3-(4-fluorophenyl)-N-[4-[1-hydroxy-5-[2-(4-methylpiperazin-1-yl)ethoxy]-6-nitrobenzimidazol-2-yl]phenyl]prop-2-enamide (PubChem CID 25060842) has the molecular formula C29H29FN6O5 and a molecular weight of 560.59 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[4-[1-hydroxy-5-[2-(4-methylpiperazin-1-yl)ethoxy]-6-nitrobenzimidazol-2-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[4-[1-hydroxy-5-[2-(4-methylpiperazin-1-yl)ethoxy]-6-nitrobenzimidazol-2-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 25060842 |
| Molecular Formula | C29H29FN6O5 |
| Molecular Weight | 560.59 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[4-[1-hydroxy-5-[2-(4-methylpiperazin-1-yl)ethoxy]-6-nitrobenzimidazol-2-yl]phenyl]prop-2-enamide |
| SMILES | CN1CCN(CCOc2cc3nc(-c4ccc(NC(=O)/C=C/c5ccc(F)cc5)cc4)n(O)c3cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C29H29FN6O5/c1-33-12-14-34(15-13-33)16-17-41-27-18-24-25(19-26(27)36(39)40)35(38)29(32-24)21-5-9-23(10-6-21)31-28(37)11-4-20-2-7-22(30)8-3-20/h2-11,18-19,38H,12-17H2,1H3,(H,31,37)/b11-4+ |
| InChIKey | LNDMSUBUIZTBRQ-NYYWCZLTSA-N |
| XLogP | 4.27 |
| TPSA | 126.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.59 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|