C27H27FN6O4 — CID 25060844
(E)-N-[4-[7-[2-(dimethylamino)ethyl-methylamino]-1-hydroxy-6-nitrobenzimidazol-2-yl]phenyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 25060844) has the molecular formula C27H27FN6O4 and a molecular weight of 518.55 g/mol. Its IUPAC name is (E)-N-[4-[7-[2-(dimethylamino)ethyl-methylamino]-1-hydroxy-6-nitrobenzimidazol-2-yl]phenyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[7-[2-(dimethylamino)ethyl-methylamino]-1-hydroxy-6-nitrobenzimidazol-2-yl]phenyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 25060844 |
| Molecular Formula | C27H27FN6O4 |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | (E)-N-[4-[7-[2-(dimethylamino)ethyl-methylamino]-1-hydroxy-6-nitrobenzimidazol-2-yl]phenyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | CN(C)CCN(C)c1c([N+](=O)[O-])ccc2nc(-c3ccc(NC(=O)/C=C/c4ccc(F)cc4)cc3)n(O)c12 |
| InChI | InChI=1S/C27H27FN6O4/c1-31(2)16-17-32(3)26-23(34(37)38)14-13-22-25(26)33(36)27(30-22)19-7-11-21(12-8-19)29-24(35)15-6-18-4-9-20(28)10-5-18/h4-15,36H,16-17H2,1-3H3,(H,29,35)/b15-6+ |
| InChIKey | VYAITZWUJPMXPK-GIDUJCDVSA-N |
| XLogP | 4.64 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|